C19H27NO3Si — CID 101386968
(4R)-3-[(3R,4S)-4-hydroxy-5-methyl-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101386968) has the molecular formula C19H27NO3Si and a molecular weight of 345.52 g/mol. Its IUPAC name is (4R)-3-[(3R,4S)-4-hydroxy-5-methyl-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3R,4S)-4-hydroxy-5-methyl-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101386968 |
| Molecular Formula | C19H27NO3Si |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (4R)-3-[(3R,4S)-4-hydroxy-5-methyl-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H](O)[C@@H](C#C[Si](C)(C)C)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H27NO3Si/c1-14(2)18(21)16(11-12-24(3,4)5)20-17(13-23-19(20)22)15-9-7-6-8-10-15/h6-10,14,16-18,21H,13H2,1-5H3/t16-,17+,18+/m1/s1 |
| InChIKey | FNBIBHBMISNRMG-SQNIBIBYSA-N |
| XLogP | 3.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|