C23H24N2O4S2 — CID 101388218
N-[2-(benzenesulfonamido)-4,5-dimethyl-3-prop-2-enylphenyl]benzenesulfonamide (PubChem CID 101388218) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)-4,5-dimethyl-3-prop-2-enylphenyl]benzenesulfonamide.
| Compound Name | N-[2-(benzenesulfonamido)-4,5-dimethyl-3-prop-2-enylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101388218 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[2-(benzenesulfonamido)-4,5-dimethyl-3-prop-2-enylphenyl]benzenesulfonamide |
| SMILES | C=CCc1c(C)c(C)cc(NS(=O)(=O)c2ccccc2)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-4-11-21-18(3)17(2)16-22(24-30(26,27)19-12-7-5-8-13-19)23(21)25-31(28,29)20-14-9-6-10-15-20/h4-10,12-16,24-25H,1,11H2,2-3H3 |
| InChIKey | QENKBIFRNHTMII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|