C11H13NO3S — CID 101389240
3-[(3S)-3-thiophen-2-ylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 101389240) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(3S)-3-thiophen-2-ylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-thiophen-2-ylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101389240 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-[(3S)-3-thiophen-2-ylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CC(=O)N1CCOC1=O)c1cccs1 |
| InChI | InChI=1S/C11H13NO3S/c1-8(9-3-2-6-16-9)7-10(13)12-4-5-15-11(12)14/h2-3,6,8H,4-5,7H2,1H3/t8-/m0/s1 |
| InChIKey | BBJUXQCDGBRXRT-QMMMGPOBSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |