C14H18O2 — CID 101389868
(2S)-2-[hydroxy(phenyl)methyl]-2-methylcyclohexan-1-one (PubChem CID 101389868) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S)-2-[hydroxy(phenyl)methyl]-2-methylcyclohexan-1-one.
| Compound Name | (2S)-2-[hydroxy(phenyl)methyl]-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 101389868 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S)-2-[hydroxy(phenyl)methyl]-2-methylcyclohexan-1-one |
| SMILES | C[C@@]1(C(O)c2ccccc2)CCCCC1=O |
| InChI | InChI=1S/C14H18O2/c1-14(10-6-5-9-12(14)15)13(16)11-7-3-2-4-8-11/h2-4,7-8,13,16H,5-6,9-10H2,1H3/t13?,14-/m1/s1 |
| InChIKey | OBNSGPGWBHNHOX-ARLHGKGLSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |