C16H18O2 — CID 101389872
(2S)-2-(1-hydroxy-3-phenylprop-2-ynyl)-2-methylcyclohexan-1-one (PubChem CID 101389872) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2S)-2-(1-hydroxy-3-phenylprop-2-ynyl)-2-methylcyclohexan-1-one.
| Compound Name | (2S)-2-(1-hydroxy-3-phenylprop-2-ynyl)-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 101389872 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2S)-2-(1-hydroxy-3-phenylprop-2-ynyl)-2-methylcyclohexan-1-one |
| SMILES | C[C@@]1(C(O)C#Cc2ccccc2)CCCCC1=O |
| InChI | InChI=1S/C16H18O2/c1-16(12-6-5-9-14(16)17)15(18)11-10-13-7-3-2-4-8-13/h2-4,7-8,15,18H,5-6,9,12H2,1H3/t15?,16-/m1/s1 |
| InChIKey | SLECAKAONBKPCP-OEMAIJDKSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|