C18H27NO4 — CID 101391156
7-O-tert-butyl 2-O-ethyl (1R,2R,3S,4S)-3-but-3-enyl-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate (PubChem CID 101391156) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-ethyl (1R,2R,3S,4S)-3-but-3-enyl-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-ethyl (1R,2R,3S,4S)-3-but-3-enyl-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 101391156 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 7-O-tert-butyl 2-O-ethyl (1R,2R,3S,4S)-3-but-3-enyl-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate |
| SMILES | C=CCC[C@H]1[C@@H](C(=O)OCC)[C@H]2C=C[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-6-8-9-12-13-10-11-14(15(12)16(20)22-7-2)19(13)17(21)23-18(3,4)5/h6,10-15H,1,7-9H2,2-5H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | IBNCZBHSVGJTBG-LXTVHRRPSA-N |
| XLogP | 3.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|