C18H18OS — CID 101392254
[(1Z,3E)-5-methoxy-1-phenylpenta-1,3-dien-2-yl]sulfanylbenzene (PubChem CID 101392254) has the molecular formula C18H18OS and a molecular weight of 282.41 g/mol. Its IUPAC name is [(1Z,3E)-5-methoxy-1-phenylpenta-1,3-dien-2-yl]sulfanylbenzene.
| Compound Name | [(1Z,3E)-5-methoxy-1-phenylpenta-1,3-dien-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 101392254 |
| Molecular Formula | C18H18OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(1Z,3E)-5-methoxy-1-phenylpenta-1,3-dien-2-yl]sulfanylbenzene |
| SMILES | COC/C=C/C(=C/c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C18H18OS/c1-19-14-8-13-18(15-16-9-4-2-5-10-16)20-17-11-6-3-7-12-17/h2-13,15H,14H2,1H3/b13-8+,18-15- |
| InChIKey | UTJXRWODRZTCEX-XKOIKILESA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|