C12H23NOS3 — CID 101393638
2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)-N-propan-2-ylpropanamide (PubChem CID 101393638) has the molecular formula C12H23NOS3 and a molecular weight of 293.52 g/mol. Its IUPAC name is 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)-N-propan-2-ylpropanamide.
| Compound Name | 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 101393638 |
| Molecular Formula | C12H23NOS3 |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)-N-propan-2-ylpropanamide |
| SMILES | CC(C)CSC(=S)SC(C)(C)C(=O)NC(C)C |
| InChI | InChI=1S/C12H23NOS3/c1-8(2)7-16-11(15)17-12(5,6)10(14)13-9(3)4/h8-9H,7H2,1-6H3,(H,13,14) |
| InChIKey | ZYPDOBVJZLMSOQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|