C14H26O2S3 — CID 123193850
3-methyl-3-(2,4,4-trimethylpentylsulfanylcarbothioylsulfanyl)butanoic acid (PubChem CID 123193850) has the molecular formula C14H26O2S3 and a molecular weight of 322.56 g/mol. Its IUPAC name is 3-methyl-3-(2,4,4-trimethylpentylsulfanylcarbothioylsulfanyl)butanoic acid.
| Compound Name | 3-methyl-3-(2,4,4-trimethylpentylsulfanylcarbothioylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 123193850 |
| Molecular Formula | C14H26O2S3 |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-methyl-3-(2,4,4-trimethylpentylsulfanylcarbothioylsulfanyl)butanoic acid |
| SMILES | CC(CSC(=S)SC(C)(C)CC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C14H26O2S3/c1-10(7-13(2,3)4)9-18-12(17)19-14(5,6)8-11(15)16/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | BRSOZKPAYLNZFZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|