About 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid
3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid (PubChem CID 122011161) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid.
Molecular Properties
| Compound Name | 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid |
| PubChem CID | 122011161 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid |
| SMILES | CC(CCNC(=O)NCCC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-10(9-13(2,3)4)5-7-14-12(18)15-8-6-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)(H2,14,15,18) |
| InChIKey | NPTSFGIPVAXYOC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid?
The IUPAC name of 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid (CID 122011161) is 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid.
What is the SMILES notation for 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid?
The canonical SMILES for 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid is CC(CCNC(=O)NCCC(=O)O)CC(C)(C)C.
What is the InChIKey of 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid?
The InChIKey is NPTSFGIPVAXYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-10(9-13(2,3)4)5-7-14-12(18)15-8-6-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)(H2,14,15,18).
What are the key properties of 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid?
3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid has a molecular weight of 258.36 g/mol, XLogP of 2.22, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5,5-trimethylhexylcarbamoylamino)propanoic acid is sourced from PubChem (CID 122011161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).