C12H19NO2S3 — CID 118283332
4-cyano-4-(2-methylbutylsulfanylcarbothioylsulfanyl)pentanoic acid (PubChem CID 118283332) has the molecular formula C12H19NO2S3 and a molecular weight of 305.49 g/mol. Its IUPAC name is 4-cyano-4-(2-methylbutylsulfanylcarbothioylsulfanyl)pentanoic acid.
| Compound Name | 4-cyano-4-(2-methylbutylsulfanylcarbothioylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 118283332 |
| Molecular Formula | C12H19NO2S3 |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-cyano-4-(2-methylbutylsulfanylcarbothioylsulfanyl)pentanoic acid |
| SMILES | CCC(C)CSC(=S)SC(C)(C#N)CCC(=O)O |
| InChI | InChI=1S/C12H19NO2S3/c1-4-9(2)7-17-11(16)18-12(3,8-13)6-5-10(14)15/h9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | UVSIZLIWNUCHHB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|