C17H29NO2S3 — CID 146188350
4-cyano-4-(2,2,5,5-tetramethylhexylsulfanylcarbothioylsulfanyl)pentanoic acid (PubChem CID 146188350) has the molecular formula C17H29NO2S3 and a molecular weight of 375.63 g/mol. Its IUPAC name is 4-cyano-4-(2,2,5,5-tetramethylhexylsulfanylcarbothioylsulfanyl)pentanoic acid.
| Compound Name | 4-cyano-4-(2,2,5,5-tetramethylhexylsulfanylcarbothioylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 146188350 |
| Molecular Formula | C17H29NO2S3 |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-cyano-4-(2,2,5,5-tetramethylhexylsulfanylcarbothioylsulfanyl)pentanoic acid |
| SMILES | CC(C)(C)CCC(C)(C)CSC(=S)SC(C)(C#N)CCC(=O)O |
| InChI | InChI=1S/C17H29NO2S3/c1-15(2,3)9-10-16(4,5)12-22-14(21)23-17(6,11-18)8-7-13(19)20/h7-10,12H2,1-6H3,(H,19,20) |
| InChIKey | FNGSTXGYPYQSSA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|