C10H15NO2S2 — CID 134565525
3-cyano-3-(2,2-dimethylpropanethioylsulfanyl)butanoic acid (PubChem CID 134565525) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-cyano-3-(2,2-dimethylpropanethioylsulfanyl)butanoic acid.
| Compound Name | 3-cyano-3-(2,2-dimethylpropanethioylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 134565525 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-cyano-3-(2,2-dimethylpropanethioylsulfanyl)butanoic acid |
| SMILES | CC(C#N)(CC(=O)O)SC(=S)C(C)(C)C |
| InChI | InChI=1S/C10H15NO2S2/c1-9(2,3)8(14)15-10(4,6-11)5-7(12)13/h5H2,1-4H3,(H,12,13) |
| InChIKey | XSIJMWOTVNYCDP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|