C8H13NO8 — CID 158026503
acetonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate (PubChem CID 158026503) has the molecular formula C8H13NO8 and a molecular weight of 251.19 g/mol. Its IUPAC name is acetonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate.
| Compound Name | acetonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
|---|---|
| PubChem CID | 158026503 |
| Molecular Formula | C8H13NO8 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | acetonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| SMILES | CC#N.O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C2H3N.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2-3;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3;1H2 |
| InChIKey | HIBPALZHZQDBMT-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 187.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |