C11H17NO3S2 — CID 141377710
4-butylsulfanylcarbonylsulfanyl-4-cyanopentanoic acid (PubChem CID 141377710) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-butylsulfanylcarbonylsulfanyl-4-cyanopentanoic acid.
| Compound Name | 4-butylsulfanylcarbonylsulfanyl-4-cyanopentanoic acid |
|---|---|
| PubChem CID | 141377710 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-butylsulfanylcarbonylsulfanyl-4-cyanopentanoic acid |
| SMILES | CCCCSC(=O)SC(C)(C#N)CCC(=O)O |
| InChI | InChI=1S/C11H17NO3S2/c1-3-4-7-16-10(15)17-11(2,8-12)6-5-9(13)14/h3-7H2,1-2H3,(H,13,14) |
| InChIKey | XPWLCJOGAIATMS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|