C10H15NOS3 — CID 146188670
2-ethylsulfanylcarbothioylsulfanyl-5-hydroxy-2-methylhex-5-enenitrile (PubChem CID 146188670) has the molecular formula C10H15NOS3 and a molecular weight of 261.44 g/mol. Its IUPAC name is 2-ethylsulfanylcarbothioylsulfanyl-5-hydroxy-2-methylhex-5-enenitrile.
| Compound Name | 2-ethylsulfanylcarbothioylsulfanyl-5-hydroxy-2-methylhex-5-enenitrile |
|---|---|
| PubChem CID | 146188670 |
| Molecular Formula | C10H15NOS3 |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-ethylsulfanylcarbothioylsulfanyl-5-hydroxy-2-methylhex-5-enenitrile |
| SMILES | C=C(O)CCC(C)(C#N)SC(=S)SCC |
| InChI | InChI=1S/C10H15NOS3/c1-4-14-9(13)15-10(3,7-11)6-5-8(2)12/h12H,2,4-6H2,1,3H3 |
| InChIKey | BGENNSPAHQMUHN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|