About pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate
pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate (PubChem CID 132519979) has the molecular formula C26H23NO2S3
and a molecular weight of 477.68 g/mol. Its IUPAC name is pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate.
Molecular Properties
| Compound Name | pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate |
| PubChem CID | 132519979 |
| Molecular Formula | C26H23NO2S3 |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate |
| SMILES | CCSC(=S)SC(C)(C#N)CCC(=O)OCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C26H23NO2S3/c1-3-31-25(30)32-26(2,16-27)14-13-22(28)29-15-20-10-9-19-8-7-17-5-4-6-18-11-12-21(20)24(19)23(17)18/h4-12H,3,13-15H2,1-2H3 |
| InChIKey | TULBZHVGSDKXQB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate?
The IUPAC name of pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate (CID 132519979) is pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate.
What is the SMILES notation for pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate?
The canonical SMILES for pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate is CCSC(=S)SC(C)(C#N)CCC(=O)OCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate?
The InChIKey is TULBZHVGSDKXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO2S3/c1-3-31-25(30)32-26(2,16-27)14-13-22(28)29-15-20-10-9-19-8-7-17-5-4-6-18-11-12-21(20)24(19)23(17)18/h4-12H,3,13-15H2,1-2H3.
What are the key properties of pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate?
pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate has a molecular weight of 477.68 g/mol, XLogP of 7.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-ylmethyl 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoate is sourced from PubChem (CID 132519979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).