C19H32N2O2S3 — CID 145127305
4-cyano-4-ethylsulfanylcarbothioylsulfanyl-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide (PubChem CID 145127305) has the molecular formula C19H32N2O2S3 and a molecular weight of 416.68 g/mol. Its IUPAC name is 4-cyano-4-ethylsulfanylcarbothioylsulfanyl-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide.
| Compound Name | 4-cyano-4-ethylsulfanylcarbothioylsulfanyl-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide |
|---|---|
| PubChem CID | 145127305 |
| Molecular Formula | C19H32N2O2S3 |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-cyano-4-ethylsulfanylcarbothioylsulfanyl-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide |
| SMILES | C=C(C)CCOC(C)(C)CCNC(=O)CCC(C)(C#N)SC(=S)SCC |
| InChI | InChI=1S/C19H32N2O2S3/c1-7-25-17(24)26-19(6,14-20)10-8-16(22)21-12-11-18(4,5)23-13-9-15(2)3/h2,7-13H2,1,3-6H3,(H,21,22) |
| InChIKey | ORGWNKCDOSZILS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|