C21H35N3O4S5 — CID 175840851
2-[[4-[2-[(4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoyl)amino]ethyldisulfanyl]-4-methylpentanoyl]-methylamino]propanoic acid (PubChem CID 175840851) has the molecular formula C21H35N3O4S5 and a molecular weight of 553.86 g/mol. Its IUPAC name is 2-[[4-[2-[(4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoyl)amino]ethyldisulfanyl]-4-methylpentanoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[4-[2-[(4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoyl)amino]ethyldisulfanyl]-4-methylpentanoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 175840851 |
| Molecular Formula | C21H35N3O4S5 |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2-[[4-[2-[(4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoyl)amino]ethyldisulfanyl]-4-methylpentanoyl]-methylamino]propanoic acid |
| SMILES | CCSC(=S)SC(C)(C#N)CCC(=O)NCCSSC(C)(C)CCC(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C21H35N3O4S5/c1-7-30-19(29)32-21(5,14-22)11-8-16(25)23-12-13-31-33-20(3,4)10-9-17(26)24(6)15(2)18(27)28/h15H,7-13H2,1-6H3,(H,23,25)(H,27,28) |
| InChIKey | UHBILVLPDXTHCD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|