C17H32N4O6S — CID 175867349
2-[methyl-[3-[2-[2-[2-(propanoylamino)ethylcarbamothioylamino]ethoxy]ethoxy]propanoyl]amino]propanoic acid (PubChem CID 175867349) has the molecular formula C17H32N4O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[methyl-[3-[2-[2-[2-(propanoylamino)ethylcarbamothioylamino]ethoxy]ethoxy]propanoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[3-[2-[2-[2-(propanoylamino)ethylcarbamothioylamino]ethoxy]ethoxy]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175867349 |
| Molecular Formula | C17H32N4O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[methyl-[3-[2-[2-[2-(propanoylamino)ethylcarbamothioylamino]ethoxy]ethoxy]propanoyl]amino]propanoic acid |
| SMILES | CCC(=O)NCCNC(=S)NCCOCCOCCC(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C17H32N4O6S/c1-4-14(22)18-6-7-19-17(28)20-8-10-27-12-11-26-9-5-15(23)21(3)13(2)16(24)25/h13H,4-12H2,1-3H3,(H,18,22)(H,24,25)(H2,19,20,28) |
| InChIKey | DSALGPVJVXDEIL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|