C28H44BrNO2S4 — CID 89128101
[2-[5-(2-bromopropan-2-yl)-3-hexylthiophen-2-yl]-2-methylpropyl] 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate (PubChem CID 89128101) has the molecular formula C28H44BrNO2S4 and a molecular weight of 634.84 g/mol. Its IUPAC name is [2-[5-(2-bromopropan-2-yl)-3-hexylthiophen-2-yl]-2-methylpropyl] 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate.
| Compound Name | [2-[5-(2-bromopropan-2-yl)-3-hexylthiophen-2-yl]-2-methylpropyl] 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate |
|---|---|
| PubChem CID | 89128101 |
| Molecular Formula | C28H44BrNO2S4 |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | [2-[5-(2-bromopropan-2-yl)-3-hexylthiophen-2-yl]-2-methylpropyl] 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate |
| SMILES | CCCCCCc1cc(C(C)(C)Br)sc1C(C)(C)COC(=O)CCC(C)(C#N)SC(=S)SCCCC |
| InChI | InChI=1S/C28H44BrNO2S4/c1-8-10-12-13-14-21-18-22(27(5,6)29)35-24(21)26(3,4)20-32-23(31)15-16-28(7,19-30)36-25(33)34-17-11-9-2/h18H,8-17,20H2,1-7H3 |
| InChIKey | NQUUUQOJHASKQA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|