C22H32BrNO2S4 — CID 58338929
(5-bromo-3-hexylthiophen-2-yl)methyl 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate (PubChem CID 58338929) has the molecular formula C22H32BrNO2S4 and a molecular weight of 550.68 g/mol. Its IUPAC name is (5-bromo-3-hexylthiophen-2-yl)methyl 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate.
| Compound Name | (5-bromo-3-hexylthiophen-2-yl)methyl 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate |
|---|---|
| PubChem CID | 58338929 |
| Molecular Formula | C22H32BrNO2S4 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | (5-bromo-3-hexylthiophen-2-yl)methyl 4-butylsulfanylcarbothioylsulfanyl-4-cyanopentanoate |
| SMILES | CCCCCCc1cc(Br)sc1COC(=O)CCC(C)(C#N)SC(=S)SCCCC |
| InChI | InChI=1S/C22H32BrNO2S4/c1-4-6-8-9-10-17-14-19(23)29-18(17)15-26-20(25)11-12-22(3,16-24)30-21(27)28-13-7-5-2/h14H,4-13,15H2,1-3H3 |
| InChIKey | DPPREQFNFYONNB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|