C27H32N2O — CID 101393786
[(2S)-1-[(2R)-2-(dibenzylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol (PubChem CID 101393786) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-(dibenzylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(2R)-2-(dibenzylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 101393786 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [(2S)-1-[(2R)-2-(dibenzylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1C[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O/c30-22-26-17-10-18-28(26)21-27(25-15-8-3-9-16-25)29(19-23-11-4-1-5-12-23)20-24-13-6-2-7-14-24/h1-9,11-16,26-27,30H,10,17-22H2/t26-,27-/m0/s1 |
| InChIKey | UCWUCKVOUOSWEM-SVBPBHIXSA-N |
| XLogP | 4.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |