C26H30N2O — CID 11501921
[(2S)-1-[(2R)-2-(benzhydrylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol (PubChem CID 11501921) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-(benzhydrylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(2R)-2-(benzhydrylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 11501921 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [(2S)-1-[(2R)-2-(benzhydrylamino)-2-phenylethyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1C[C@H](NC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O/c29-20-24-17-10-18-28(24)19-25(21-11-4-1-5-12-21)27-26(22-13-6-2-7-14-22)23-15-8-3-9-16-23/h1-9,11-16,24-27,29H,10,17-20H2/t24-,25-/m0/s1 |
| InChIKey | NPLGBOGULWUOJS-DQEYMECFSA-N |
| XLogP | 4.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |