C17H26N2O2 — CID 77439017
3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(3-phenylprop-2-enylamino)propan-1-ol (PubChem CID 77439017) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(3-phenylprop-2-enylamino)propan-1-ol.
| Compound Name | 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(3-phenylprop-2-enylamino)propan-1-ol |
|---|---|
| PubChem CID | 77439017 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(3-phenylprop-2-enylamino)propan-1-ol |
| SMILES | OCC(CN1CCCC1CO)NCC=Cc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c20-13-16(12-19-11-5-9-17(19)14-21)18-10-4-8-15-6-2-1-3-7-15/h1-4,6-8,16-18,20-21H,5,9-14H2 |
| InChIKey | MMNBNFAFXQLFNE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |