C9H13NO4 — CID 101394619
(4S,7S,8S,9R,11S)-8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one (PubChem CID 101394619) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (4S,7S,8S,9R,11S)-8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one.
| Compound Name | (4S,7S,8S,9R,11S)-8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one |
|---|---|
| PubChem CID | 101394619 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (4S,7S,8S,9R,11S)-8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one |
| SMILES | O=C1O[C@H]2CCN3C[C@@H](O)[C@@H](O)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C9H13NO4/c11-4-3-10-2-1-5-7(10)6(8(4)12)9(13)14-5/h4-8,11-12H,1-3H2/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | HXENLFZTMNNZHP-DWOUCZDBSA-N |
| XLogP | -1.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |