About 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one
8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one (PubChem CID 130148179) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one.
Analyze 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one?
The IUPAC name of 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one (CID 130148179) is 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one.
What is the SMILES notation for 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one?
The canonical SMILES for 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one is O=C1OC2CCN3CC(O)C(O)C1C23.
What is the InChIKey of 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one?
The InChIKey is HXENLFZTMNNZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c11-4-3-10-2-1-5-7(10)6(8(4)12)9(13)14-5/h4-8,11-12H,1-3H2.
What are the key properties of 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one?
8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one has a molecular weight of 199.21 g/mol, XLogP of -1.66, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydroxy-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one is sourced from PubChem (CID 130148179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).