About (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol
(Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol (PubChem CID 101394701) has the molecular formula C14H28OS2Si
and a molecular weight of 304.60 g/mol. Its IUPAC name is (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol.
Molecular Properties
| Compound Name | (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol |
| PubChem CID | 101394701 |
| Molecular Formula | C14H28OS2Si |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol |
| SMILES | C/C=C(/CC(O)CC1SCCCS1)C[Si](C)(C)C |
| InChI | InChI=1S/C14H28OS2Si/c1-5-12(11-18(2,3)4)9-13(15)10-14-16-7-6-8-17-14/h5,13-15H,6-11H2,1-4H3/b12-5- |
| InChIKey | WVOVJUADEWEUSI-XGICHPGQSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol?
The IUPAC name of (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol (CID 101394701) is (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol.
What is the SMILES notation for (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol?
The canonical SMILES for (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol is C/C=C(/CC(O)CC1SCCCS1)C[Si](C)(C)C.
What is the InChIKey of (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol?
The InChIKey is WVOVJUADEWEUSI-XGICHPGQSA-N. The full InChI is InChI=1S/C14H28OS2Si/c1-5-12(11-18(2,3)4)9-13(15)10-14-16-7-6-8-17-14/h5,13-15H,6-11H2,1-4H3/b12-5-.
What are the key properties of (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol?
(Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol has a molecular weight of 304.60 g/mol, XLogP of 4.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,3-dithian-2-yl)-4-(trimethylsilylmethyl)hex-4-en-2-ol is sourced from PubChem (CID 101394701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).