C27H32N4O3 — CID 10139485
4-methyl-6-[[4-[3-(2-methylquinolin-5-yl)oxypropyl]piperazin-1-yl]methyl]-1,4-benzoxazin-3-one (PubChem CID 10139485) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-methyl-6-[[4-[3-(2-methylquinolin-5-yl)oxypropyl]piperazin-1-yl]methyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-methyl-6-[[4-[3-(2-methylquinolin-5-yl)oxypropyl]piperazin-1-yl]methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10139485 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 4-methyl-6-[[4-[3-(2-methylquinolin-5-yl)oxypropyl]piperazin-1-yl]methyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(OCCCN3CCN(Cc4ccc5c(c4)N(C)C(=O)CO5)CC3)cccc2n1 |
| InChI | InChI=1S/C27H32N4O3/c1-20-7-9-22-23(28-20)5-3-6-25(22)33-16-4-11-30-12-14-31(15-13-30)18-21-8-10-26-24(17-21)29(2)27(32)19-34-26/h3,5-10,17H,4,11-16,18-19H2,1-2H3 |
| InChIKey | DMOBJCFLUVKUPL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|