C26H28ClN3O4 — CID 10184428
6-[1-[3-(7-chloro-2-methylquinolin-5-yl)oxypropyl]piperidin-4-yl]oxy-4H-1,4-benzoxazin-3-one (PubChem CID 10184428) has the molecular formula C26H28ClN3O4 and a molecular weight of 481.98 g/mol. Its IUPAC name is 6-[1-[3-(7-chloro-2-methylquinolin-5-yl)oxypropyl]piperidin-4-yl]oxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-[3-(7-chloro-2-methylquinolin-5-yl)oxypropyl]piperidin-4-yl]oxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10184428 |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 6-[1-[3-(7-chloro-2-methylquinolin-5-yl)oxypropyl]piperidin-4-yl]oxy-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(OCCCN3CCC(Oc4ccc5c(c4)NC(=O)CO5)CC3)cc(Cl)cc2n1 |
| InChI | InChI=1S/C26H28ClN3O4/c1-17-3-5-21-22(28-17)13-18(27)14-25(21)32-12-2-9-30-10-7-19(8-11-30)34-20-4-6-24-23(15-20)29-26(31)16-33-24/h3-6,13-15,19H,2,7-12,16H2,1H3,(H,29,31) |
| InChIKey | FWBMABRIBDMSDK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|