C21H15F4N5O3 — CID 10139513
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(aminomethylidene)carbamate (PubChem CID 10139513) has the molecular formula C21H15F4N5O3 and a molecular weight of 461.38 g/mol. Its IUPAC name is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(aminomethylidene)carbamate.
| Compound Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(aminomethylidene)carbamate |
|---|---|
| PubChem CID | 10139513 |
| Molecular Formula | C21H15F4N5O3 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(aminomethylidene)carbamate |
| SMILES | N/C=N/C(=O)OCc1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F4N5O3/c22-12-5-6-13(16(25)8-12)18-11(9-33-21(32)28-10-26)4-7-17(29-18)30(20(27)31)19-14(23)2-1-3-15(19)24/h1-8,10H,9H2,(H2,27,31)(H2,26,28,32) |
| InChIKey | QOLVQQMVNIJPLI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|