C15H20O5 — CID 101395665
(5E)-5-[[(3R,6S)-6-[(E)-4-hydroxybut-2-en-2-yl]-3-methyldioxan-3-yl]methylidene]-3-methylfuran-2-one (PubChem CID 101395665) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (5E)-5-[[(3R,6S)-6-[(E)-4-hydroxybut-2-en-2-yl]-3-methyldioxan-3-yl]methylidene]-3-methylfuran-2-one.
| Compound Name | (5E)-5-[[(3R,6S)-6-[(E)-4-hydroxybut-2-en-2-yl]-3-methyldioxan-3-yl]methylidene]-3-methylfuran-2-one |
|---|---|
| PubChem CID | 101395665 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (5E)-5-[[(3R,6S)-6-[(E)-4-hydroxybut-2-en-2-yl]-3-methyldioxan-3-yl]methylidene]-3-methylfuran-2-one |
| SMILES | CC1=C/C(=C\[C@@]2(C)CC[C@@H](/C(C)=C/CO)OO2)OC1=O |
| InChI | InChI=1S/C15H20O5/c1-10(5-7-16)13-4-6-15(3,20-19-13)9-12-8-11(2)14(17)18-12/h5,8-9,13,16H,4,6-7H2,1-3H3/b10-5+,12-9+/t13-,15+/m0/s1 |
| InChIKey | YGYHRCDXYXLQEH-WACHIWKVSA-N |
| XLogP | 2.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|