C8H12O3 — CID 175032922
3-methylfuran-2,5-dione;propane (PubChem CID 175032922) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-methylfuran-2,5-dione;propane.
| Compound Name | 3-methylfuran-2,5-dione;propane |
|---|---|
| PubChem CID | 175032922 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3-methylfuran-2,5-dione;propane |
| SMILES | CC1=CC(=O)OC1=O.CCC |
| InChI | InChI=1S/C5H4O3.C3H8/c1-3-2-4(6)8-5(3)7;1-3-2/h2H,1H3;3H2,1-2H3 |
| InChIKey | AHESXMOXMSMGSU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|