C18H30O3 — CID 10565758
3-tetradecylfuran-2,5-dione (PubChem CID 10565758) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 3-tetradecylfuran-2,5-dione.
| Compound Name | 3-tetradecylfuran-2,5-dione |
|---|---|
| PubChem CID | 10565758 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3-tetradecylfuran-2,5-dione |
| SMILES | CCCCCCCCCCCCCCC1=CC(=O)OC1=O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-15-17(19)21-18(16)20/h15H,2-14H2,1H3 |
| InChIKey | WPLVTAIGBCNROX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|