C17H30O3 — CID 101395815
octyl (2Z)-2-(2-hydroxy-4,4-dimethylcyclopentylidene)acetate (PubChem CID 101395815) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is octyl (2Z)-2-(2-hydroxy-4,4-dimethylcyclopentylidene)acetate.
| Compound Name | octyl (2Z)-2-(2-hydroxy-4,4-dimethylcyclopentylidene)acetate |
|---|---|
| PubChem CID | 101395815 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | octyl (2Z)-2-(2-hydroxy-4,4-dimethylcyclopentylidene)acetate |
| SMILES | CCCCCCCCOC(=O)/C=C1/CC(C)(C)CC1O |
| InChI | InChI=1S/C17H30O3/c1-4-5-6-7-8-9-10-20-16(19)11-14-12-17(2,3)13-15(14)18/h11,15,18H,4-10,12-13H2,1-3H3/b14-11- |
| InChIKey | OLYOKERACIKPMD-KAMYIIQDSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|