C22H33NO4S — CID 101395823
octyl 2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-1-yl]acetate (PubChem CID 101395823) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is octyl 2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-1-yl]acetate.
| Compound Name | octyl 2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-1-yl]acetate |
|---|---|
| PubChem CID | 101395823 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | octyl 2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-1-yl]acetate |
| SMILES | CCCCCCCCOC(=O)CC12CC1CN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C22H33NO4S/c1-3-4-5-6-7-8-13-27-21(24)15-22-14-19(22)16-23(17-22)28(25,26)20-11-9-18(2)10-12-20/h9-12,19H,3-8,13-17H2,1-2H3 |
| InChIKey | LELJRLDKPYVXJS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|