C24H19ClN2O7 — CID 101395910
[(19S)-19-acetyloxy-10-chloro-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] acetate (PubChem CID 101395910) has the molecular formula C24H19ClN2O7 and a molecular weight of 482.88 g/mol. Its IUPAC name is [(19S)-19-acetyloxy-10-chloro-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] acetate.
| Compound Name | [(19S)-19-acetyloxy-10-chloro-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] acetate |
|---|---|
| PubChem CID | 101395910 |
| Molecular Formula | C24H19ClN2O7 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | [(19S)-19-acetyloxy-10-chloro-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] acetate |
| SMILES | CC[C@@]1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(OC(C)=O)cc1c2Cl |
| InChI | InChI=1S/C24H19ClN2O7/c1-4-24(34-12(3)29)17-8-19-21-15(9-27(19)22(30)16(17)10-32-23(24)31)20(25)14-7-13(33-11(2)28)5-6-18(14)26-21/h5-8H,4,9-10H2,1-3H3/t24-/m0/s1 |
| InChIKey | RXHBLRSDYLAOPW-DEOSSOPVSA-N |
| XLogP | 3.23 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|