C29H33ClN2O7Si — CID 88912394
[10,19-diethyl-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropoxy]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] carbonochloridate (PubChem CID 88912394) has the molecular formula C29H33ClN2O7Si and a molecular weight of 585.13 g/mol. Its IUPAC name is [10,19-diethyl-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropoxy]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] carbonochloridate.
| Compound Name | [10,19-diethyl-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropoxy]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] carbonochloridate |
|---|---|
| PubChem CID | 88912394 |
| Molecular Formula | C29H33ClN2O7Si |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | [10,19-diethyl-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropoxy]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] carbonochloridate |
| SMILES | CCc1c2c(nc3ccc(OCC(C)(C)[Si](C)(C)O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(CC)OC(=O)Cl |
| InChI | InChI=1S/C29H33ClN2O7Si/c1-7-17-18-11-16(38-15-28(3,4)40(5,6)36)9-10-22(18)31-24-19(17)13-32-23(24)12-21-20(25(32)33)14-37-26(34)29(21,8-2)39-27(30)35/h9-12,36H,7-8,13-15H2,1-6H3 |
| InChIKey | FLWTULINDADPGU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|