C26H22ClIN2O8 — CID 88559315
tert-butyl [(19R)-19-carbonochloridoyloxy-10-ethyl-19-iodo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate (PubChem CID 88559315) has the molecular formula C26H22ClIN2O8 and a molecular weight of 652.83 g/mol. Its IUPAC name is tert-butyl [(19R)-19-carbonochloridoyloxy-10-ethyl-19-iodo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate.
| Compound Name | tert-butyl [(19R)-19-carbonochloridoyloxy-10-ethyl-19-iodo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
|---|---|
| PubChem CID | 88559315 |
| Molecular Formula | C26H22ClIN2O8 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.01 |
| IUPAC Name | tert-butyl [(19R)-19-carbonochloridoyloxy-10-ethyl-19-iodo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)(C)C)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@@]3(I)OC(=O)Cl |
| InChI | InChI=1S/C26H22ClIN2O8/c1-5-13-14-8-12(36-24(34)38-25(2,3)4)6-7-18(14)29-20-15(13)10-30-19(20)9-17-16(21(30)31)11-35-22(32)26(17,28)37-23(27)33/h6-9H,5,10-11H2,1-4H3/t26-/m0/s1 |
| InChIKey | KEIIMLRPCSKSDL-SANMLTNESA-N |
| XLogP | 5.32 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|