C25H23ClN2O7 — CID 123339502
1-chloroethyl (10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate (PubChem CID 123339502) has the molecular formula C25H23ClN2O7 and a molecular weight of 498.92 g/mol. Its IUPAC name is 1-chloroethyl (10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate.
| Compound Name | 1-chloroethyl (10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate |
|---|---|
| PubChem CID | 123339502 |
| Molecular Formula | C25H23ClN2O7 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-chloroethyl (10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)Cl)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
| InChI | InChI=1S/C25H23ClN2O7/c1-4-14-15-8-13(35-24(31)34-12(3)26)6-7-19(15)27-21-16(14)10-28-20(21)9-18-17(22(28)29)11-33-23(30)25(18,32)5-2/h6-9,12,32H,4-5,10-11H2,1-3H3 |
| InChIKey | HZHJBTVFJRSVSP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|