C31H25IN2O9 — CID 90146827
(4-carboniodidoyloxyphenyl)methyl [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate (PubChem CID 90146827) has the molecular formula C31H25IN2O9 and a molecular weight of 696.45 g/mol. Its IUPAC name is (4-carboniodidoyloxyphenyl)methyl [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate.
| Compound Name | (4-carboniodidoyloxyphenyl)methyl [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
|---|---|
| PubChem CID | 90146827 |
| Molecular Formula | C31H25IN2O9 |
| Molecular Weight | 696.45 g/mol |
| Exact Mass | 696.06 |
| IUPAC Name | (4-carboniodidoyloxyphenyl)methyl [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OCc4ccc(OC(=O)I)cc4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C31H25IN2O9/c1-3-19-20-11-18(43-30(38)41-14-16-5-7-17(8-6-16)42-29(32)37)9-10-24(20)33-26-21(19)13-34-25(26)12-23-22(27(34)35)15-40-28(36)31(23,39)4-2/h5-12,39H,3-4,13-15H2,1-2H3/t31-/m0/s1 |
| InChIKey | OMWJCVRBQWXEDN-HKBQPEDESA-N |
| XLogP | 5.29 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|