C41H52N2O7 — CID 59516351
[(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] [(9Z,12Z)-octadeca-9,12-dienyl] carbonate (PubChem CID 59516351) has the molecular formula C41H52N2O7 and a molecular weight of 684.87 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] [(9Z,12Z)-octadeca-9,12-dienyl] carbonate.
| Compound Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] [(9Z,12Z)-octadeca-9,12-dienyl] carbonate |
|---|---|
| PubChem CID | 59516351 |
| Molecular Formula | C41H52N2O7 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] [(9Z,12Z)-octadeca-9,12-dienyl] carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)Oc1ccc2nc3c(c(CC)c2c1)Cn1c-3cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C41H52N2O7/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-48-40(46)50-29-22-23-35-31(25-29)30(5-2)32-27-43-36(37(32)42-35)26-34-33(38(43)44)28-49-39(45)41(34,47)6-3/h10-11,13-14,22-23,25-26,47H,4-9,12,15-21,24,27-28H2,1-3H3/b11-10-,14-13-/t41-/m0/s1 |
| InChIKey | VDMZCBFERRQYLM-PAYTZNERSA-N |
| XLogP | 8.97 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|