C25H52O3Si2 — CID 101396006
(8S)-8-triethylsilyloxy-10-tri(propan-2-yl)silyloxydec-1-en-4-one (PubChem CID 101396006) has the molecular formula C25H52O3Si2 and a molecular weight of 456.86 g/mol. Its IUPAC name is (8S)-8-triethylsilyloxy-10-tri(propan-2-yl)silyloxydec-1-en-4-one.
| Compound Name | (8S)-8-triethylsilyloxy-10-tri(propan-2-yl)silyloxydec-1-en-4-one |
|---|---|
| PubChem CID | 101396006 |
| Molecular Formula | C25H52O3Si2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (8S)-8-triethylsilyloxy-10-tri(propan-2-yl)silyloxydec-1-en-4-one |
| SMILES | C=CCC(=O)CCC[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H52O3Si2/c1-11-16-24(26)17-15-18-25(28-29(12-2,13-3)14-4)19-20-27-30(21(5)6,22(7)8)23(9)10/h11,21-23,25H,1,12-20H2,2-10H3/t25-/m0/s1 |
| InChIKey | XLZOSODXFCFIFW-VWLOTQADSA-N |
| XLogP | 8.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|