C24H46O3Si2 — CID 101396371
(1R,2R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2E)-6-methylhepta-2,5-dien-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-ol (PubChem CID 101396371) has the molecular formula C24H46O3Si2 and a molecular weight of 438.80 g/mol. Its IUPAC name is (1R,2R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2E)-6-methylhepta-2,5-dien-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-ol.
| Compound Name | (1R,2R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2E)-6-methylhepta-2,5-dien-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 101396371 |
| Molecular Formula | C24H46O3Si2 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (1R,2R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2E)-6-methylhepta-2,5-dien-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-ol |
| SMILES | CC(C)=CC/C=C(\C)[C@H]1C=C(O[Si](C)(C)C)CC[C@]1(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O3Si2/c1-19(2)13-12-14-20(3)22-17-21(27-28(7,8)9)15-16-24(22,25)18-26-29(10,11)23(4,5)6/h13-14,17,22,25H,12,15-16,18H2,1-11H3/b20-14+/t22-,24+/m1/s1 |
| InChIKey | PLBLMGOATKSUQO-ZTZJABTBSA-N |
| XLogP | 7.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|