C24H48O2Si2 — CID 11475786
tert-butyl-dimethyl-[[(1S,2R)-2-[(E)-6-methylhept-2-en-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-yl]methoxy]silane (PubChem CID 11475786) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2R)-2-[(E)-6-methylhept-2-en-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2R)-2-[(E)-6-methylhept-2-en-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 11475786 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2R)-2-[(E)-6-methylhept-2-en-2-yl]-4-trimethylsilyloxycyclohex-3-en-1-yl]methoxy]silane |
| SMILES | C/C(=C\CCC(C)C)[C@H]1C=C(O[Si](C)(C)C)CC[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O2Si2/c1-19(2)13-12-14-20(3)23-17-22(26-27(7,8)9)16-15-21(23)18-25-28(10,11)24(4,5)6/h14,17,19,21,23H,12-13,15-16,18H2,1-11H3/b20-14+/t21-,23-/m1/s1 |
| InChIKey | CXFDIJAESUDPJW-FZAMCVDASA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|