C19H38O2Si2 — CID 15448027
[(Z)-4,4-dimethyl-1-(3-trimethylsilyloxycyclohex-2-en-1-yl)pent-2-en-3-yl]oxy-trimethylsilane (PubChem CID 15448027) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is [(Z)-4,4-dimethyl-1-(3-trimethylsilyloxycyclohex-2-en-1-yl)pent-2-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(Z)-4,4-dimethyl-1-(3-trimethylsilyloxycyclohex-2-en-1-yl)pent-2-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15448027 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(Z)-4,4-dimethyl-1-(3-trimethylsilyloxycyclohex-2-en-1-yl)pent-2-en-3-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)/C(=C/CC1C=C(O[Si](C)(C)C)CCC1)O[Si](C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-19(2,3)18(21-23(7,8)9)14-13-16-11-10-12-17(15-16)20-22(4,5)6/h14-16H,10-13H2,1-9H3/b18-14- |
| InChIKey | XJNKUSSNTLYLEL-JXAWBTAJSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|