C16H28N3+ — CID 101399528
(1S,4S,6R,10R)-6-methyl-10-(4-methylpent-3-enyl)-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene (PubChem CID 101399528) has the molecular formula C16H28N3+ and a molecular weight of 262.42 g/mol. Its IUPAC name is (1S,4S,6R,10R)-6-methyl-10-(4-methylpent-3-enyl)-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene.
| Compound Name | (1S,4S,6R,10R)-6-methyl-10-(4-methylpent-3-enyl)-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
|---|---|
| PubChem CID | 101399528 |
| Molecular Formula | C16H28N3+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (1S,4S,6R,10R)-6-methyl-10-(4-methylpent-3-enyl)-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
| SMILES | CC(C)=CCC[C@@H]1C[C@@H]2CC[C@H]3C[C@@H](C)NC(=[N+]23)N1 |
| InChI | InChI=1S/C16H27N3/c1-11(2)5-4-6-13-10-15-8-7-14-9-12(3)17-16(18-13)19(14)15/h5,12-15H,4,6-10H2,1-3H3,(H,17,18)/p+1/t12-,13-,14+,15+/m1/s1 |
| InChIKey | HTDWIVAXBXFKBP-KBXIAJHMSA-O |
| XLogP | 2.38 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|