C14H24OSi — CID 101399598
[(5S,6R,8aR)-4,6-dimethyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane (PubChem CID 101399598) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is [(5S,6R,8aR)-4,6-dimethyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane.
| Compound Name | [(5S,6R,8aR)-4,6-dimethyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101399598 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [(5S,6R,8aR)-4,6-dimethyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane |
| SMILES | CC1=C2COC[C@@H]2C=C[C@@H](C)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-10-6-7-12-8-15-9-13(12)11(2)14(10)16(3,4)5/h6-7,10,12,14H,8-9H2,1-5H3/t10-,12+,14+/m1/s1 |
| InChIKey | PMEQMNFFKATMKS-OSMZGAPFSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|