C12H20OSi — CID 11401534
[(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]-trimethylsilane (PubChem CID 11401534) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]-trimethylsilane.
| Compound Name | [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11401534 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]-trimethylsilane |
| SMILES | C[C@@H]1C=C[C@@H]2COCC2=C1[Si](C)(C)C |
| InChI | InChI=1S/C12H20OSi/c1-9-5-6-10-7-13-8-11(10)12(9)14(2,3)4/h5-6,9-10H,7-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | VPYQVNRYUQSFHS-NXEZZACHSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|