C8H10O — CID 90881271
1,3,3a,6-tetrahydro-2-benzofuran (PubChem CID 90881271) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,3,3a,6-tetrahydro-2-benzofuran.
| Compound Name | 1,3,3a,6-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 90881271 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1,3,3a,6-tetrahydro-2-benzofuran |
| SMILES | C1=CC2COCC2=CC1 |
| InChI | InChI=1S/C8H10O/c1-2-4-8-6-9-5-7(8)3-1/h1,3-4,7H,2,5-6H2 |
| InChIKey | FMPCWPCQBQXJKO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|